C9H13N3O3 — CID 110849279
N-(2-methoxyethyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 110849279) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110849279 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc(C)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3/c1-6-11-5-7(9(14)12-6)8(13)10-3-4-15-2/h5H,3-4H2,1-2H3,(H,10,13)(H,11,12,14) |
| InChIKey | LSBZDPMEHNVISC-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|