C17H20N2O3S — CID 144556813
N-hydroxy-2-[4-[3-(phenylsulfanylamino)propoxy]phenyl]acetamide (PubChem CID 144556813) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-hydroxy-2-[4-[3-(phenylsulfanylamino)propoxy]phenyl]acetamide.
| Compound Name | N-hydroxy-2-[4-[3-(phenylsulfanylamino)propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 144556813 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-hydroxy-2-[4-[3-(phenylsulfanylamino)propoxy]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OCCCNSc2ccccc2)cc1)NO |
| InChI | InChI=1S/C17H20N2O3S/c20-17(19-21)13-14-7-9-15(10-8-14)22-12-4-11-18-23-16-5-2-1-3-6-16/h1-3,5-10,18,21H,4,11-13H2,(H,19,20) |
| InChIKey | OPMPDZNPFHNKII-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|