About ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate
ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate (PubChem CID 144557460) has the molecular formula C28H31NO3
and a molecular weight of 429.56 g/mol. Its IUPAC name is ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate |
| PubChem CID | 144557460 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate |
| SMILES | CC.CCNC(=O)c1ccc2ccccc2c1.CCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H13NO.C13H12O2.C2H6/c1-2-14-13(15)12-8-7-10-5-3-4-6-11(10)9-12;1-2-15-13(14)12-8-7-10-5-3-4-6-11(10)9-12;1-2/h3-9H,2H2,1H3,(H,14,15);3-9H,2H2,1H3;1-2H3 |
| InChIKey | ZPJCHCYYLPMIOH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate?
The IUPAC name of ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate (CID 144557460) is ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate.
What is the SMILES notation for ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate?
The canonical SMILES for ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate is CC.CCNC(=O)c1ccc2ccccc2c1.CCOC(=O)c1ccc2ccccc2c1.
What is the InChIKey of ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate?
The InChIKey is ZPJCHCYYLPMIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO.C13H12O2.C2H6/c1-2-14-13(15)12-8-7-10-5-3-4-6-11(10)9-12;1-2-15-13(14)12-8-7-10-5-3-4-6-11(10)9-12;1-2/h3-9H,2H2,1H3,(H,14,15);3-9H,2H2,1H3;1-2H3.
What are the key properties of ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate?
ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate has a molecular weight of 429.56 g/mol, XLogP of 6.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethylnaphthalene-2-carboxamide;ethyl naphthalene-2-carboxylate is sourced from PubChem (CID 144557460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).