C20H17Cl2N9O — CID 144557996
2-[[(2-amino-8-chloropyrazolo[1,5-a][1,3,5]triazin-4-yl)-ethylamino]methyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 144557996) has the molecular formula C20H17Cl2N9O and a molecular weight of 470.32 g/mol. Its IUPAC name is 2-[[(2-amino-8-chloropyrazolo[1,5-a][1,3,5]triazin-4-yl)-ethylamino]methyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[[(2-amino-8-chloropyrazolo[1,5-a][1,3,5]triazin-4-yl)-ethylamino]methyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 144557996 |
| Molecular Formula | C20H17Cl2N9O |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[[(2-amino-8-chloropyrazolo[1,5-a][1,3,5]triazin-4-yl)-ethylamino]methyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCN(Cc1nn2ccc(Cl)c2c(=O)n1-c1ccccc1)c1nc(N)nc2c(Cl)cnn12 |
| InChI | InChI=1S/C20H17Cl2N9O/c1-2-28(20-26-19(23)25-17-14(22)10-24-31(17)20)11-15-27-29-9-8-13(21)16(29)18(32)30(15)12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H2,23,25) |
| InChIKey | JFVYLJXMVNOWPQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |