C18H18N8O — CID 144558044
N-[amino-[(2S)-1-(5-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-2-yl]methylidene]-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 144558044) has the molecular formula C18H18N8O and a molecular weight of 362.40 g/mol. Its IUPAC name is N-[amino-[(2S)-1-(5-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-2-yl]methylidene]-5-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[amino-[(2S)-1-(5-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-2-yl]methylidene]-5-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 144558044 |
| Molecular Formula | C18H18N8O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[amino-[(2S)-1-(5-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-2-yl]methylidene]-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)/N=C(\N)[C@@H]2CCCN2c2ncnc3[nH]cc(C#N)c23)[nH]1 |
| InChI | InChI=1S/C18H18N8O/c1-10-4-5-12(24-10)18(27)25-15(20)13-3-2-6-26(13)17-14-11(7-19)8-21-16(14)22-9-23-17/h4-5,8-9,13,24H,2-3,6H2,1H3,(H2,20,25,27)(H,21,22,23)/t13-/m0/s1 |
| InChIKey | JABAZBMJLZEWBP-ZDUSSCGKSA-N |
| XLogP | 1.63 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|