C10H18N2O2 — CID 144558595
ethyl 4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 144558595) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is ethyl 4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 144558595 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | ethyl 4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=C(C)C(NC)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-4-14-10(13)12-6-5-8(2)9(7-12)11-3/h5,9,11H,4,6-7H2,1-3H3 |
| InChIKey | QUBHMFMCOLJCGM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|