C20H18FN3O2S — CID 144559669
methyl 6-[[2-(3,6-dihydro-2H-pyridin-1-yl)-6-fluoro-1,3-benzothiazol-4-yl]methyl]pyridine-2-carboxylate (PubChem CID 144559669) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 6-[[2-(3,6-dihydro-2H-pyridin-1-yl)-6-fluoro-1,3-benzothiazol-4-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[2-(3,6-dihydro-2H-pyridin-1-yl)-6-fluoro-1,3-benzothiazol-4-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 144559669 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 6-[[2-(3,6-dihydro-2H-pyridin-1-yl)-6-fluoro-1,3-benzothiazol-4-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Cc2cc(F)cc3sc(N4CC=CCC4)nc23)n1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-26-19(25)16-7-5-6-15(22-16)11-13-10-14(21)12-17-18(13)23-20(27-17)24-8-3-2-4-9-24/h2-3,5-7,10,12H,4,8-9,11H2,1H3 |
| InChIKey | AKGDJGOHACVQEN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|