About (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane
(1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane (PubChem CID 144560644) has the molecular formula C20H39O3P
and a molecular weight of 358.50 g/mol. Its IUPAC name is (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane.
Molecular Properties
| Compound Name | (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane |
| PubChem CID | 144560644 |
| Molecular Formula | C20H39O3P |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane |
| SMILES | C1CCCC1.C=C(PC)C(=O)OC(CC(C)C)OC1CCC1.CC |
| InChI | InChI=1S/C13H23O3P.C5H10.C2H6/c1-9(2)8-12(15-11-6-5-7-11)16-13(14)10(3)17-4;1-2-4-5-3-1;1-2/h9,11-12,17H,3,5-8H2,1-2,4H3;1-5H2;1-2H3 |
| InChIKey | JINKQAYSKCOOKI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane?
The IUPAC name of (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane (CID 144560644) is (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane.
What is the SMILES notation for (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane?
The canonical SMILES for (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane is C1CCCC1.C=C(PC)C(=O)OC(CC(C)C)OC1CCC1.CC.
What is the InChIKey of (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane?
The InChIKey is JINKQAYSKCOOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23O3P.C5H10.C2H6/c1-9(2)8-12(15-11-6-5-7-11)16-13(14)10(3)17-4;1-2-4-5-3-1;1-2/h9,11-12,17H,3,5-8H2,1-2,4H3;1-5H2;1-2H3.
What are the key properties of (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane?
(1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane has a molecular weight of 358.50 g/mol, XLogP of 6.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclobutyloxy-3-methylbutyl) 2-methylphosphanylprop-2-enoate;cyclopentane;ethane is sourced from PubChem (CID 144560644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).