C19H28O2 — CID 144561096
1-(1-methoxy-2,2-dimethylpropoxy)-4-(2-methylhexa-4,5-dien-3-yl)benzene (PubChem CID 144561096) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-(1-methoxy-2,2-dimethylpropoxy)-4-(2-methylhexa-4,5-dien-3-yl)benzene.
| Compound Name | 1-(1-methoxy-2,2-dimethylpropoxy)-4-(2-methylhexa-4,5-dien-3-yl)benzene |
|---|---|
| PubChem CID | 144561096 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-(1-methoxy-2,2-dimethylpropoxy)-4-(2-methylhexa-4,5-dien-3-yl)benzene |
| SMILES | C=C=CC(c1ccc(OC(OC)C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C19H28O2/c1-8-9-17(14(2)3)15-10-12-16(13-11-15)21-18(20-7)19(4,5)6/h9-14,17-18H,1H2,2-7H3 |
| InChIKey | HVCZPZVSIYAPAO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|