C17H20FN2O- — CID 144562629
[(2Z,4Z,6Z)-1-(2-fluorophenyl)-4-[(1R)-1-hydroxyethyl]-1-iminoocta-2,4,6-trien-3-yl]-methylazanide (PubChem CID 144562629) has the molecular formula C17H20FN2O- and a molecular weight of 287.36 g/mol. Its IUPAC name is [(2Z,4Z,6Z)-1-(2-fluorophenyl)-4-[(1R)-1-hydroxyethyl]-1-iminoocta-2,4,6-trien-3-yl]-methylazanide.
| Compound Name | [(2Z,4Z,6Z)-1-(2-fluorophenyl)-4-[(1R)-1-hydroxyethyl]-1-iminoocta-2,4,6-trien-3-yl]-methylazanide |
|---|---|
| PubChem CID | 144562629 |
| Molecular Formula | C17H20FN2O- |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [(2Z,4Z,6Z)-1-(2-fluorophenyl)-4-[(1R)-1-hydroxyethyl]-1-iminoocta-2,4,6-trien-3-yl]-methylazanide |
| SMILES | [H]/N=C(\C=C([N-]C)\C(=C\C=C/C)[C@@H](C)O)c1ccccc1F |
| InChI | InChI=1S/C17H20FN2O/c1-4-5-8-13(12(2)21)17(20-3)11-16(19)14-9-6-7-10-15(14)18/h4-12,19,21H,1-3H3/q-1/b5-4-,13-8+,17-11-,19-16+/t12-/m1/s1 |
| InChIKey | CBWBELKIKPNWQQ-ZOLONMOLSA-N |
| XLogP | 3.96 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|