C17H21FN2O — CID 144562630
(2R,3Z,5Z)-3-[C-[2-amino-2-(2-fluorophenyl)ethenyl]-N-methylcarbonimidoyl]hepta-3,5-dien-2-ol (PubChem CID 144562630) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is (2R,3Z,5Z)-3-[C-[2-amino-2-(2-fluorophenyl)ethenyl]-N-methylcarbonimidoyl]hepta-3,5-dien-2-ol.
| Compound Name | (2R,3Z,5Z)-3-[C-[2-amino-2-(2-fluorophenyl)ethenyl]-N-methylcarbonimidoyl]hepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 144562630 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2R,3Z,5Z)-3-[C-[2-amino-2-(2-fluorophenyl)ethenyl]-N-methylcarbonimidoyl]hepta-3,5-dien-2-ol |
| SMILES | C/C=C\C=C(C(\C=C(N)c1ccccc1F)=N/C)/[C@@H](C)O |
| InChI | InChI=1S/C17H21FN2O/c1-4-5-8-13(12(2)21)17(20-3)11-16(19)14-9-6-7-10-15(14)18/h4-12,21H,19H2,1-3H3/b5-4-,13-8+,16-11?,20-17-/t12-/m1/s1 |
| InChIKey | FZPHJKHUBLJWAE-ISUKMVSESA-N |
| XLogP | 3.08 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|