C14H21N3O3 — CID 144562779
(3aS,6aR)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 144562779) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3aS,6aR)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3aS,6aR)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 144562779 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3aS,6aR)-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(CNC(=O)C1NC[C@@H]2CCC[C@H]12)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H21N3O3/c18-11(13(19)17-9-4-5-9)7-16-14(20)12-10-3-1-2-8(10)6-15-12/h8-10,12,15H,1-7H2,(H,16,20)(H,17,19)/t8-,10-,12?/m0/s1 |
| InChIKey | XKWQCIWEGDJCDU-KWHPKRGUSA-N |
| XLogP | -0.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|