C13H15NO4S — CID 144563894
ethyl 2-[[2-(4-methylsulfanylphenyl)-2-oxoethyl]amino]-2-oxoacetate (PubChem CID 144563894) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is ethyl 2-[[2-(4-methylsulfanylphenyl)-2-oxoethyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[2-(4-methylsulfanylphenyl)-2-oxoethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 144563894 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl 2-[[2-(4-methylsulfanylphenyl)-2-oxoethyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C13H15NO4S/c1-3-18-13(17)12(16)14-8-11(15)9-4-6-10(19-2)7-5-9/h4-7H,3,8H2,1-2H3,(H,14,16) |
| InChIKey | GCXLQDXGLQKGTG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|