C20H28O4 — CID 144567834
2,3-dimethoxy-5-methyl-6-[1-methyl-2-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 144567834) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[1-methyl-2-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[1-methyl-2-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 144567834 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[1-methyl-2-[(E)-2,3,3-trimethylbut-1-enyl]cyclopropyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C2(C)CC2/C=C(\C)C(C)(C)C)=C(C)C1=O |
| InChI | InChI=1S/C20H28O4/c1-11(19(3,4)5)9-13-10-20(13,6)14-12(2)15(21)17(23-7)18(24-8)16(14)22/h9,13H,10H2,1-8H3/b11-9+ |
| InChIKey | JGVLTKBZSSFVBN-PKNBQFBNSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|