C21H22ClF2NO — CID 144567934
(3E)-3-[[5-chloro-3-(3,4-difluorophenyl)-2-methylphenyl]methylidene]piperidin-2-one;ethane (PubChem CID 144567934) has the molecular formula C21H22ClF2NO and a molecular weight of 377.86 g/mol. Its IUPAC name is (3E)-3-[[5-chloro-3-(3,4-difluorophenyl)-2-methylphenyl]methylidene]piperidin-2-one;ethane.
| Compound Name | (3E)-3-[[5-chloro-3-(3,4-difluorophenyl)-2-methylphenyl]methylidene]piperidin-2-one;ethane |
|---|---|
| PubChem CID | 144567934 |
| Molecular Formula | C21H22ClF2NO |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (3E)-3-[[5-chloro-3-(3,4-difluorophenyl)-2-methylphenyl]methylidene]piperidin-2-one;ethane |
| SMILES | CC.Cc1c(/C=C2\CCCNC2=O)cc(Cl)cc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16ClF2NO.C2H6/c1-11-14(7-13-3-2-6-23-19(13)24)8-15(20)10-16(11)12-4-5-17(21)18(22)9-12;1-2/h4-5,7-10H,2-3,6H2,1H3,(H,23,24);1-2H3/b13-7+; |
| InChIKey | CVBMRKZHMGZXLK-FTPOTTDRSA-N |
| XLogP | 5.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|