C25H27N5O2 — CID 144568228
N-[5-[(E)-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-2-methylpyrazole-3-carboxamide (PubChem CID 144568228) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[5-[(E)-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[5-[(E)-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 144568228 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[5-[(E)-3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-2,3,6,7-tetrahydroazepin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-2-methylpyrazole-3-carboxamide |
| SMILES | C=C/C=C(\C=C)C1=CCCN(C(=O)/C=C/c2ccc(NC(=O)c3ccnn3C)nc2)CC1 |
| InChI | InChI=1S/C25H27N5O2/c1-4-7-20(5-2)21-8-6-16-30(17-14-21)24(31)12-10-19-9-11-23(26-18-19)28-25(32)22-13-15-27-29(22)3/h4-5,7-13,15,18H,1-2,6,14,16-17H2,3H3,(H,26,28,32)/b12-10+,20-7+ |
| InChIKey | UNGMOYDZLFMKPV-BOOUZQSRSA-N |
| XLogP | 3.93 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|