About 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate
2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate (PubChem CID 144568273) has the molecular formula C10H15FO3S2
and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate.
Molecular Properties
| Compound Name | 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate |
| PubChem CID | 144568273 |
| Molecular Formula | C10H15FO3S2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate |
| SMILES | CS(=O)OCCS(=O)CC1=CCCC(F)=C1 |
| InChI | InChI=1S/C10H15FO3S2/c1-15(12)14-5-6-16(13)8-9-3-2-4-10(11)7-9/h3,7H,2,4-6,8H2,1H3 |
| InChIKey | GUEUZZJVTNVZIO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate?
The IUPAC name of 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate (CID 144568273) is 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate.
What is the SMILES notation for 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate?
The canonical SMILES for 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate is CS(=O)OCCS(=O)CC1=CCCC(F)=C1.
What is the InChIKey of 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate?
The InChIKey is GUEUZZJVTNVZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FO3S2/c1-15(12)14-5-6-16(13)8-9-3-2-4-10(11)7-9/h3,7H,2,4-6,8H2,1H3.
What are the key properties of 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate?
2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate has a molecular weight of 266.36 g/mol, XLogP of 1.62, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-fluorocyclohexa-1,5-dien-1-yl)methylsulfinyl]ethyl methanesulfinate is sourced from PubChem (CID 144568273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).