C11H18O2S — CID 170732564
2-(3-methoxypropylsulfinylmethyl)cyclohexa-1,3-diene (PubChem CID 170732564) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-(3-methoxypropylsulfinylmethyl)cyclohexa-1,3-diene.
| Compound Name | 2-(3-methoxypropylsulfinylmethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170732564 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-(3-methoxypropylsulfinylmethyl)cyclohexa-1,3-diene |
| SMILES | COCCCS(=O)CC1=CCCC=C1 |
| InChI | InChI=1S/C11H18O2S/c1-13-8-5-9-14(12)10-11-6-3-2-4-7-11/h3,6-7H,2,4-5,8-10H2,1H3 |
| InChIKey | CUHSQLUKNDWTIU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|