C13H22O2S — CID 143341688
5,6-bis(ethenyl)-3-methylidene-4H-thiopyran 1-oxide;ethane;methanol (PubChem CID 143341688) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3-methylidene-4H-thiopyran 1-oxide;ethane;methanol.
| Compound Name | 5,6-bis(ethenyl)-3-methylidene-4H-thiopyran 1-oxide;ethane;methanol |
|---|---|
| PubChem CID | 143341688 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5,6-bis(ethenyl)-3-methylidene-4H-thiopyran 1-oxide;ethane;methanol |
| SMILES | C=CC1=C(C=C)S(=O)CC(=C)C1.CC.CO |
| InChI | InChI=1S/C10H12OS.C2H6.CH4O/c1-4-9-6-8(3)7-12(11)10(9)5-2;2*1-2/h4-5H,1-3,6-7H2;1-2H3;2H,1H3 |
| InChIKey | TZIXINQULNJRGH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|