About 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol
5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol (PubChem CID 143341105) has the molecular formula C12H18O2S
and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol.
Molecular Properties
| Compound Name | 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol |
| PubChem CID | 143341105 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol |
| SMILES | C=CC1=C(/C=C\C)S(=O)C(=C)CC1.CO |
| InChI | InChI=1S/C11H14OS.CH4O/c1-4-6-11-10(5-2)8-7-9(3)13(11)12;1-2/h4-6H,2-3,7-8H2,1H3;2H,1H3/b6-4-; |
| InChIKey | UELQBRJFULZBGO-YHSAGPEESA-N |
| XLogP | 2.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol?
The IUPAC name of 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol (CID 143341105) is 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol.
What is the SMILES notation for 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol?
The canonical SMILES for 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol is C=CC1=C(/C=C\C)S(=O)C(=C)CC1.CO.
What is the InChIKey of 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol?
The InChIKey is UELQBRJFULZBGO-YHSAGPEESA-N. The full InChI is InChI=1S/C11H14OS.CH4O/c1-4-6-11-10(5-2)8-7-9(3)13(11)12;1-2/h4-6H,2-3,7-8H2,1H3;2H,1H3/b6-4-;.
What are the key properties of 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol?
5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol has a molecular weight of 226.34 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2-methylidene-6-[(Z)-prop-1-enyl]-3,4-dihydrothiopyran 1-oxide;methanol is sourced from PubChem (CID 143341105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).