C14H18O2S — CID 146991717
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfonyl-4-methylcyclohexa-1,3-diene (PubChem CID 146991717) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfonyl-4-methylcyclohexa-1,3-diene.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfonyl-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 146991717 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfonyl-4-methylcyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C/C)S(=O)(=O)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C14H18O2S/c1-4-6-13(7-5-2)17(15,16)14-10-8-12(3)9-11-14/h4-8,10H,1,9,11H2,2-3H3/b7-5-,13-6+ |
| InChIKey | AQHYIXHSHLWGIZ-IILXRZLBSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|