C12H18O2S — CID 6420273
3,4-dimethyl-2,5-bis(prop-2-enyl)-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 6420273) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-bis(prop-2-enyl)-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | 3,4-dimethyl-2,5-bis(prop-2-enyl)-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 6420273 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3,4-dimethyl-2,5-bis(prop-2-enyl)-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | C=CCC1C(C)=C(C)C(CC=C)S1(=O)=O |
| InChI | InChI=1S/C12H18O2S/c1-5-7-11-9(3)10(4)12(8-6-2)15(11,13)14/h5-6,11-12H,1-2,7-8H2,3-4H3 |
| InChIKey | NRBLKXPBBOBNKF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|