C11H20O2S — CID 15550936
(3S)-3-tert-butylsulfonylcycloheptene (PubChem CID 15550936) has the molecular formula C11H20O2S and a molecular weight of 216.35 g/mol. Its IUPAC name is (3S)-3-tert-butylsulfonylcycloheptene.
| Compound Name | (3S)-3-tert-butylsulfonylcycloheptene |
|---|---|
| PubChem CID | 15550936 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3S)-3-tert-butylsulfonylcycloheptene |
| SMILES | CC(C)(C)S(=O)(=O)[C@@H]1C=CCCCC1 |
| InChI | InChI=1S/C11H20O2S/c1-11(2,3)14(12,13)10-8-6-4-5-7-9-10/h6,8,10H,4-5,7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | UYGRUVOQFJDGRO-SNVBAGLBSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|