C10H18O2S — CID 10932538
(3S)-3-tert-butylsulfonylcyclohexene (PubChem CID 10932538) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (3S)-3-tert-butylsulfonylcyclohexene.
| Compound Name | (3S)-3-tert-butylsulfonylcyclohexene |
|---|---|
| PubChem CID | 10932538 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3S)-3-tert-butylsulfonylcyclohexene |
| SMILES | CC(C)(C)S(=O)(=O)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C10H18O2S/c1-10(2,3)13(11,12)9-7-5-4-6-8-9/h5,7,9H,4,6,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | MVDULLGHRRVLFL-SECBINFHSA-N |
| XLogP | 2.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|