C12H22O2S — CID 15550937
(1Z,3S)-3-tert-butylsulfonylcyclooctene (PubChem CID 15550937) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is (1Z,3S)-3-tert-butylsulfonylcyclooctene.
| Compound Name | (1Z,3S)-3-tert-butylsulfonylcyclooctene |
|---|---|
| PubChem CID | 15550937 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1Z,3S)-3-tert-butylsulfonylcyclooctene |
| SMILES | CC(C)(C)S(=O)(=O)[C@@H]1/C=C\CCCCC1 |
| InChI | InChI=1S/C12H22O2S/c1-12(2,3)15(13,14)11-9-7-5-4-6-8-10-11/h7,9,11H,4-6,8,10H2,1-3H3/b9-7-/t11-/m1/s1 |
| InChIKey | NYEHQUIZUYBTMT-GXMKHXEJSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|