About 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide
5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide (PubChem CID 143533251) has the molecular formula C11H16OS
and a molecular weight of 196.31 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide.
Analyze 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide?
The IUPAC name of 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide (CID 143533251) is 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide.
What is the SMILES notation for 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide?
The canonical SMILES for 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide is C=CC1=C(/C=C\CC)CS(=O)CC1.
What is the InChIKey of 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide?
The InChIKey is UWEGPBGLICKKPN-WAYWQWQTSA-N. The full InChI is InChI=1S/C11H16OS/c1-3-5-6-11-9-13(12)8-7-10(11)4-2/h4-6H,2-3,7-9H2,1H3/b6-5-.
What are the key properties of 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide?
5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide has a molecular weight of 196.31 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-1-enyl]-4-ethenyl-3,6-dihydro-2H-thiopyran 1-oxide is sourced from PubChem (CID 143533251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).