C16H26OS — CID 134995242
(5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfinylhepta-1,5-diene (PubChem CID 134995242) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfinylhepta-1,5-diene.
| Compound Name | (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfinylhepta-1,5-diene |
|---|---|
| PubChem CID | 134995242 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (5E)-5-methyl-7-[(2E)-3-methylhepta-2,6-dienyl]sulfinylhepta-1,5-diene |
| SMILES | C=CCC/C(C)=C/CS(=O)C/C=C(\C)CCC=C |
| InChI | InChI=1S/C16H26OS/c1-5-7-9-15(3)11-13-18(17)14-12-16(4)10-8-6-2/h5-6,11-12H,1-2,7-10,13-14H2,3-4H3/b15-11+,16-12+ |
| InChIKey | PGEXHCSQESJOER-JOBJLJCHSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|