C11H18OS — CID 15318730
(2R)-4,5-dimethyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide (PubChem CID 15318730) has the molecular formula C11H18OS and a molecular weight of 198.33 g/mol. Its IUPAC name is (2R)-4,5-dimethyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide.
| Compound Name | (2R)-4,5-dimethyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide |
|---|---|
| PubChem CID | 15318730 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (2R)-4,5-dimethyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide |
| SMILES | CC(C)=C[C@H]1CC(C)=C(C)CS1=O |
| InChI | InChI=1S/C11H18OS/c1-8(2)5-11-6-9(3)10(4)7-13(11)12/h5,11H,6-7H2,1-4H3/t11-,13?/m0/s1 |
| InChIKey | XHELWVFVTKTPSQ-AMGKYWFPSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|