C10H13F3OS — CID 91326080
2,4-dimethyl-1-(2,2,2-trifluoroethylsulfinyl)cyclohexa-1,4-diene (PubChem CID 91326080) has the molecular formula C10H13F3OS and a molecular weight of 238.27 g/mol. Its IUPAC name is 2,4-dimethyl-1-(2,2,2-trifluoroethylsulfinyl)cyclohexa-1,4-diene.
| Compound Name | 2,4-dimethyl-1-(2,2,2-trifluoroethylsulfinyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 91326080 |
| Molecular Formula | C10H13F3OS |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2,4-dimethyl-1-(2,2,2-trifluoroethylsulfinyl)cyclohexa-1,4-diene |
| SMILES | CC1=CCC(S(=O)CC(F)(F)F)=C(C)C1 |
| InChI | InChI=1S/C10H13F3OS/c1-7-3-4-9(8(2)5-7)15(14)6-10(11,12)13/h3H,4-6H2,1-2H3 |
| InChIKey | BWYJBTGRINBGBQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|