C9H11F7OS — CID 134994716
(E)-1-ethylsulfinyl-5,5,6,6,7,7,7-heptafluorohept-3-ene (PubChem CID 134994716) has the molecular formula C9H11F7OS and a molecular weight of 300.24 g/mol. Its IUPAC name is (E)-1-ethylsulfinyl-5,5,6,6,7,7,7-heptafluorohept-3-ene.
| Compound Name | (E)-1-ethylsulfinyl-5,5,6,6,7,7,7-heptafluorohept-3-ene |
|---|---|
| PubChem CID | 134994716 |
| Molecular Formula | C9H11F7OS |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (E)-1-ethylsulfinyl-5,5,6,6,7,7,7-heptafluorohept-3-ene |
| SMILES | CCS(=O)CC/C=C/C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7OS/c1-2-18(17)6-4-3-5-7(10,11)8(12,13)9(14,15)16/h3,5H,2,4,6H2,1H3/b5-3+ |
| InChIKey | AZGZYWGIWGSQEJ-HWKANZROSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|