C10H11F9O2S — CID 141170105
5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hex-2-ene (PubChem CID 141170105) has the molecular formula C10H11F9O2S and a molecular weight of 366.25 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hex-2-ene.
| Compound Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hex-2-ene |
|---|---|
| PubChem CID | 141170105 |
| Molecular Formula | C10H11F9O2S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)hex-2-ene |
| SMILES | CC=CCC(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9O2S/c1-3-4-5-6(2)22(20,21)10(18,19)8(13,14)7(11,12)9(15,16)17/h3-4,6H,5H2,1-2H3 |
| InChIKey | UOEKCMYMXVXWOF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|