About (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene
(3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene (PubChem CID 89381375) has the molecular formula C8H11F3O2S
and a molecular weight of 228.23 g/mol. Its IUPAC name is (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene.
Molecular Properties
| Compound Name | (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene |
| PubChem CID | 89381375 |
| Molecular Formula | C8H11F3O2S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene |
| SMILES | C=C[C@H](/C=C\CC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2S/c1-3-5-6-7(4-2)14(12,13)8(9,10)11/h4-7H,2-3H2,1H3/b6-5-/t7-/m1/s1 |
| InChIKey | IHSLTUGZFLICOC-KXTMECRCSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene?
The IUPAC name of (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene (CID 89381375) is (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene.
What is the SMILES notation for (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene?
The canonical SMILES for (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene is C=C[C@H](/C=C\CC)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene?
The InChIKey is IHSLTUGZFLICOC-KXTMECRCSA-N. The full InChI is InChI=1S/C8H11F3O2S/c1-3-5-6-7(4-2)14(12,13)8(9,10)11/h4-7H,2-3H2,1H3/b6-5-/t7-/m1/s1.
What are the key properties of (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene?
(3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene has a molecular weight of 228.23 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4Z)-3-(trifluoromethylsulfonyl)hepta-1,4-diene is sourced from PubChem (CID 89381375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).