C9H15F3O3S2 — CID 12577149
[(5Z)-1-methyl-3,4,7,8-tetrahydro-2H-thiocin-1-yl] trifluoromethanesulfonate (PubChem CID 12577149) has the molecular formula C9H15F3O3S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is [(5Z)-1-methyl-3,4,7,8-tetrahydro-2H-thiocin-1-yl] trifluoromethanesulfonate.
| Compound Name | [(5Z)-1-methyl-3,4,7,8-tetrahydro-2H-thiocin-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12577149 |
| Molecular Formula | C9H15F3O3S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [(5Z)-1-methyl-3,4,7,8-tetrahydro-2H-thiocin-1-yl] trifluoromethanesulfonate |
| SMILES | CS1(OS(=O)(=O)C(F)(F)F)CC/C=C\CCC1 |
| InChI | InChI=1S/C9H15F3O3S2/c1-16(7-5-3-2-4-6-8-16)15-17(13,14)9(10,11)12/h2-3H,4-8H2,1H3/b3-2- |
| InChIKey | YIUBHDSXUIGJIK-IHWYPQMZSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|