C12H18F2OS — CID 10868653
1-(difluoromethyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene (PubChem CID 10868653) has the molecular formula C12H18F2OS and a molecular weight of 248.34 g/mol. Its IUPAC name is 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene.
| Compound Name | 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 10868653 |
| Molecular Formula | C12H18F2OS |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene |
| SMILES | CCCS(=O)C1=C(C(F)F)CC(C)=C(C)C1 |
| InChI | InChI=1S/C12H18F2OS/c1-4-5-16(15)11-7-9(3)8(2)6-10(11)12(13)14/h12H,4-7H2,1-3H3 |
| InChIKey | VQNMIQVCSIQUBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|