C14H18F6OS — CID 11727757
1-(1,1,2,2,3,3-hexafluoropropyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene (PubChem CID 11727757) has the molecular formula C14H18F6OS and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoropropyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoropropyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 11727757 |
| Molecular Formula | C14H18F6OS |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoropropyl)-4,5-dimethyl-2-propylsulfinylcyclohexa-1,4-diene |
| SMILES | CCCS(=O)C1=C(C(F)(F)C(F)(F)C(F)F)CC(C)=C(C)C1 |
| InChI | InChI=1S/C14H18F6OS/c1-4-5-22(21)11-7-9(3)8(2)6-10(11)13(17,18)14(19,20)12(15)16/h12H,4-7H2,1-3H3 |
| InChIKey | PQSNVVKPXWRBEP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|