C13H20F4S — CID 147651616
1,3,4,6-tetrafluoro-5-hexylsulfanyl-2-methylcyclohexene (PubChem CID 147651616) has the molecular formula C13H20F4S and a molecular weight of 284.36 g/mol. Its IUPAC name is 1,3,4,6-tetrafluoro-5-hexylsulfanyl-2-methylcyclohexene.
| Compound Name | 1,3,4,6-tetrafluoro-5-hexylsulfanyl-2-methylcyclohexene |
|---|---|
| PubChem CID | 147651616 |
| Molecular Formula | C13H20F4S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1,3,4,6-tetrafluoro-5-hexylsulfanyl-2-methylcyclohexene |
| SMILES | CCCCCCSC1C(F)C(F)=C(C)C(F)C1F |
| InChI | InChI=1S/C13H20F4S/c1-3-4-5-6-7-18-13-11(16)9(14)8(2)10(15)12(13)17/h9,11-13H,3-7H2,1-2H3 |
| InChIKey | GJPOAMQJXHAPGE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|