C12H15F7S2 — CID 102330988
6-ethylsulfanyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-3,4-dimethyl-2,5-dihydrothiopyran (PubChem CID 102330988) has the molecular formula C12H15F7S2 and a molecular weight of 356.37 g/mol. Its IUPAC name is 6-ethylsulfanyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-3,4-dimethyl-2,5-dihydrothiopyran.
| Compound Name | 6-ethylsulfanyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-3,4-dimethyl-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 102330988 |
| Molecular Formula | C12H15F7S2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 6-ethylsulfanyl-6-(1,1,2,2,3,3,3-heptafluoropropyl)-3,4-dimethyl-2,5-dihydrothiopyran |
| SMILES | CCSC1(C(F)(F)C(F)(F)C(F)(F)F)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C12H15F7S2/c1-4-20-9(5-7(2)8(3)6-21-9)10(13,14)11(15,16)12(17,18)19/h4-6H2,1-3H3 |
| InChIKey | YDURVJZBZZNWNX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|