C10H15F3S2 — CID 15312185
6-ethylsulfanyl-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydrothiopyran (PubChem CID 15312185) has the molecular formula C10H15F3S2 and a molecular weight of 256.36 g/mol. Its IUPAC name is 6-ethylsulfanyl-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydrothiopyran.
| Compound Name | 6-ethylsulfanyl-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 15312185 |
| Molecular Formula | C10H15F3S2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 6-ethylsulfanyl-3,4-dimethyl-6-(trifluoromethyl)-2,5-dihydrothiopyran |
| SMILES | CCSC1(C(F)(F)F)CC(C)=C(C)CS1 |
| InChI | InChI=1S/C10H15F3S2/c1-4-14-9(10(11,12)13)5-7(2)8(3)6-15-9/h4-6H2,1-3H3 |
| InChIKey | QAHYGHOJJYIPAF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|