C10H10F6S2 — CID 86007747
2,2,3,3,4,4-hexafluoro-7,8-dimethyl-1,10-dithiaspiro[4.5]dec-7-ene (PubChem CID 86007747) has the molecular formula C10H10F6S2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-7,8-dimethyl-1,10-dithiaspiro[4.5]dec-7-ene.
| Compound Name | 2,2,3,3,4,4-hexafluoro-7,8-dimethyl-1,10-dithiaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 86007747 |
| Molecular Formula | C10H10F6S2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-7,8-dimethyl-1,10-dithiaspiro[4.5]dec-7-ene |
| SMILES | CC1=C(C)CC2(SC1)SC(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H10F6S2/c1-5-3-7(17-4-6(5)2)8(11,12)9(13,14)10(15,16)18-7/h3-4H2,1-2H3 |
| InChIKey | AMADSEUOIVDLOQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|