C11H12F8S — CID 14145341
4,5-dimethyl-2-(1,1,2,2,3,3,4,4-octafluorobutyl)-3,6-dihydro-2H-thiopyran (PubChem CID 14145341) has the molecular formula C11H12F8S and a molecular weight of 328.27 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1,1,2,2,3,3,4,4-octafluorobutyl)-3,6-dihydro-2H-thiopyran.
| Compound Name | 4,5-dimethyl-2-(1,1,2,2,3,3,4,4-octafluorobutyl)-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 14145341 |
| Molecular Formula | C11H12F8S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4,5-dimethyl-2-(1,1,2,2,3,3,4,4-octafluorobutyl)-3,6-dihydro-2H-thiopyran |
| SMILES | CC1=C(C)CC(C(F)(F)C(F)(F)C(F)(F)C(F)F)SC1 |
| InChI | InChI=1S/C11H12F8S/c1-5-3-7(20-4-6(5)2)9(14,15)11(18,19)10(16,17)8(12)13/h7-8H,3-4H2,1-2H3 |
| InChIKey | BWBQPZFEUUXBPQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|