C8H5F9S — CID 12947671
1-ethylsulfanyl-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene (PubChem CID 12947671) has the molecular formula C8H5F9S and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-ethylsulfanyl-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene.
| Compound Name | 1-ethylsulfanyl-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 12947671 |
| Molecular Formula | C8H5F9S |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 1-ethylsulfanyl-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene |
| SMILES | CCSC1=C(C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F9S/c1-2-18-4-3(7(13,14)15)5(9,10)8(16,17)6(4,11)12/h2H2,1H3 |
| InChIKey | LSUUVKNUYSXGIQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|