C11H17F5S — CID 146847216
(E,2R)-2,4-difluoro-3-methyl-7-(3,3,3-trifluoropropylsulfanyl)hept-3-ene (PubChem CID 146847216) has the molecular formula C11H17F5S and a molecular weight of 276.31 g/mol. Its IUPAC name is (E,2R)-2,4-difluoro-3-methyl-7-(3,3,3-trifluoropropylsulfanyl)hept-3-ene.
| Compound Name | (E,2R)-2,4-difluoro-3-methyl-7-(3,3,3-trifluoropropylsulfanyl)hept-3-ene |
|---|---|
| PubChem CID | 146847216 |
| Molecular Formula | C11H17F5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (E,2R)-2,4-difluoro-3-methyl-7-(3,3,3-trifluoropropylsulfanyl)hept-3-ene |
| SMILES | C/C(=C(\F)CCCSCCC(F)(F)F)[C@@H](C)F |
| InChI | InChI=1S/C11H17F5S/c1-8(9(2)12)10(13)4-3-6-17-7-5-11(14,15)16/h9H,3-7H2,1-2H3/b10-8+/t9-/m1/s1 |
| InChIKey | SHPOQBSRQXMRBR-NCXKZPMSSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|