C9H10F6S — CID 154316299
3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran (PubChem CID 154316299) has the molecular formula C9H10F6S and a molecular weight of 264.23 g/mol. Its IUPAC name is 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran.
| Compound Name | 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 154316299 |
| Molecular Formula | C9H10F6S |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrothiopyran |
| SMILES | CC1=C(C)CC(C(F)(F)F)(C(F)(F)F)SC1 |
| InChI | InChI=1S/C9H10F6S/c1-5-3-7(8(10,11)12,9(13,14)15)16-4-6(5)2/h3-4H2,1-2H3 |
| InChIKey | XIWZVINFGHEGIM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|