C11H13F5S — CID 123833213
3-(difluoromethyl)-2,4-dimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohexa-1,4-diene (PubChem CID 123833213) has the molecular formula C11H13F5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 3-(difluoromethyl)-2,4-dimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohexa-1,4-diene.
| Compound Name | 3-(difluoromethyl)-2,4-dimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 123833213 |
| Molecular Formula | C11H13F5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-(difluoromethyl)-2,4-dimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohexa-1,4-diene |
| SMILES | CC1=CCC(SCC(F)(F)F)=C(C)C1C(F)F |
| InChI | InChI=1S/C11H13F5S/c1-6-3-4-8(17-5-11(14,15)16)7(2)9(6)10(12)13/h3,9-10H,4-5H2,1-2H3 |
| InChIKey | ZKMVRFWQURUYFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|