C8H10F2O2S — CID 163903338
1-(difluoromethylsulfonyl)-4-methylcyclohexa-1,3-diene (PubChem CID 163903338) has the molecular formula C8H10F2O2S and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-4-methylcyclohexa-1,3-diene.
| Compound Name | 1-(difluoromethylsulfonyl)-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163903338 |
| Molecular Formula | C8H10F2O2S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-4-methylcyclohexa-1,3-diene |
| SMILES | CC1=CC=C(S(=O)(=O)C(F)F)CC1 |
| InChI | InChI=1S/C8H10F2O2S/c1-6-2-4-7(5-3-6)13(11,12)8(9)10/h2,4,8H,3,5H2,1H3 |
| InChIKey | QLTQDSAWIQGHCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |