C12H19F3O2S — CID 159499096
(1E)-2,6-dimethyl-1-(3,3,3-trifluoropropylsulfonyl)hepta-1,5-diene (PubChem CID 159499096) has the molecular formula C12H19F3O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is (1E)-2,6-dimethyl-1-(3,3,3-trifluoropropylsulfonyl)hepta-1,5-diene.
| Compound Name | (1E)-2,6-dimethyl-1-(3,3,3-trifluoropropylsulfonyl)hepta-1,5-diene |
|---|---|
| PubChem CID | 159499096 |
| Molecular Formula | C12H19F3O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (1E)-2,6-dimethyl-1-(3,3,3-trifluoropropylsulfonyl)hepta-1,5-diene |
| SMILES | CC(C)=CCC/C(C)=C/S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H19F3O2S/c1-10(2)5-4-6-11(3)9-18(16,17)8-7-12(13,14)15/h5,9H,4,6-8H2,1-3H3/b11-9+ |
| InChIKey | LZDUBTMARJEWED-PKNBQFBNSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|