C10H13F7S — CID 173027116
(E)-4,4,5,5,6,6,6-heptafluoro-3-methyl-1-propylsulfanylhex-2-ene (PubChem CID 173027116) has the molecular formula C10H13F7S and a molecular weight of 298.27 g/mol. Its IUPAC name is (E)-4,4,5,5,6,6,6-heptafluoro-3-methyl-1-propylsulfanylhex-2-ene.
| Compound Name | (E)-4,4,5,5,6,6,6-heptafluoro-3-methyl-1-propylsulfanylhex-2-ene |
|---|---|
| PubChem CID | 173027116 |
| Molecular Formula | C10H13F7S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (E)-4,4,5,5,6,6,6-heptafluoro-3-methyl-1-propylsulfanylhex-2-ene |
| SMILES | CCCSC/C=C(\C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7S/c1-3-5-18-6-4-7(2)8(11,12)9(13,14)10(15,16)17/h4H,3,5-6H2,1-2H3/b7-4+ |
| InChIKey | ALTXJFPWPQESCG-QPJJXVBHSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|