C10H16OS — CID 134994578
(1S,2S)-4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide (PubChem CID 134994578) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is (1S,2S)-4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide.
| Compound Name | (1S,2S)-4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide |
|---|---|
| PubChem CID | 134994578 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (1S,2S)-4-methyl-2-(2-methylprop-1-enyl)-3,6-dihydro-2H-thiopyran 1-oxide |
| SMILES | CC(C)=C[C@@H]1CC(C)=CC[S@@]1=O |
| InChI | InChI=1S/C10H16OS/c1-8(2)6-10-7-9(3)4-5-12(10)11/h4,6,10H,5,7H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | SSLJWVLVMZHGSF-PWSUYJOCSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|