C12H20OS — CID 143533216
5-[(Z)-but-1-enyl]-4-methyl-3,6-dihydro-2H-thiopyran 1-oxide;ethene (PubChem CID 143533216) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 5-[(Z)-but-1-enyl]-4-methyl-3,6-dihydro-2H-thiopyran 1-oxide;ethene.
| Compound Name | 5-[(Z)-but-1-enyl]-4-methyl-3,6-dihydro-2H-thiopyran 1-oxide;ethene |
|---|---|
| PubChem CID | 143533216 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-[(Z)-but-1-enyl]-4-methyl-3,6-dihydro-2H-thiopyran 1-oxide;ethene |
| SMILES | C=C.CC/C=C\C1=C(C)CCS(=O)C1 |
| InChI | InChI=1S/C10H16OS.C2H4/c1-3-4-5-10-8-12(11)7-6-9(10)2;1-2/h4-5H,3,6-8H2,1-2H3;1-2H2/b5-4-; |
| InChIKey | UCKYIVINNGCIJK-MKWAYWHRSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|