C47H36N2O5 — CID 144568615
6-[6-[9-[(9E)-11-methylidene-9-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,9,12,14-heptaenyl]-7,8-dihydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-yl]benzene-1,2,3,4,5-pentol (PubChem CID 144568615) has the molecular formula C47H36N2O5 and a molecular weight of 708.81 g/mol. Its IUPAC name is 6-[6-[9-[(9E)-11-methylidene-9-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,9,12,14-heptaenyl]-7,8-dihydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[6-[9-[(9E)-11-methylidene-9-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,9,12,14-heptaenyl]-7,8-dihydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 144568615 |
| Molecular Formula | C47H36N2O5 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | 6-[6-[9-[(9E)-11-methylidene-9-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,9,12,14-heptaenyl]-7,8-dihydrocarbazol-3-yl]-1,2-dihydrocarbazol-9-yl]benzene-1,2,3,4,5-pentol |
| SMILES | C=C1/C=C(/n2c3c(c4cc(-c5ccc6c(c5)c5c(n6-c6c(O)c(O)c(O)c(O)c6O)CCC=C5)ccc42)C=CCC3)c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C47H36N2O5/c1-26-22-41(32-13-5-3-11-30(32)23-29-10-2-4-12-31(26)29)48-37-16-8-6-14-33(37)35-24-27(18-20-39(35)48)28-19-21-40-36(25-28)34-15-7-9-17-38(34)49(40)42-43(50)45(52)47(54)46(53)44(42)51/h2-7,10-15,18-22,24-25,50-54H,1,8-9,16-17,23H2/b41-22+ |
| InChIKey | GBVZUKWLTLTFTC-YNPASXIJSA-N |
| XLogP | 10.21 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|